C12H13Cl2NO2 — CID 171186417
(4S)-4-(3,4-dichlorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one (PubChem CID 171186417) has the molecular formula C12H13Cl2NO2 and a molecular weight of 274.15 g/mol. Its IUPAC name is (4S)-4-(3,4-dichlorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one.
| Compound Name | (4S)-4-(3,4-dichlorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171186417 |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | (4S)-4-(3,4-dichlorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one |
| SMILES | CC1(C)COC(=O)N[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2NO2/c1-12(2)6-17-11(16)15-10(12)7-3-4-8(13)9(14)5-7/h3-5,10H,6H2,1-2H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | IWZTZYPCTLMTEC-JTQLQIEISA-N |
| XLogP | 3.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |