About (4S)-4-(3-bromo-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one
(4S)-4-(3-bromo-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one (PubChem CID 171186589) has the molecular formula C10H8BrF2NO3
and a molecular weight of 308.08 g/mol. Its IUPAC name is (4S)-4-(3-bromo-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | (4S)-4-(3-bromo-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one |
| PubChem CID | 171186589 |
| Molecular Formula | C10H8BrF2NO3 |
| Molecular Weight | 308.08 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | (4S)-4-(3-bromo-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one |
| SMILES | O=C1N[C@@H](c2ccc(O)c(Br)c2)C(F)(F)CO1 |
| InChI | InChI=1S/C10H8BrF2NO3/c11-6-3-5(1-2-7(6)15)8-10(12,13)4-17-9(16)14-8/h1-3,8,15H,4H2,(H,14,16)/t8-/m0/s1 |
| InChIKey | XZESPHGGSWTTOZ-QMMMGPOBSA-N |
| XLogP | 2.57 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.08 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-4-(3-bromo-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(3-bromo-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one?
The IUPAC name of (4S)-4-(3-bromo-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one (CID 171186589) is (4S)-4-(3-bromo-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one.
What is the SMILES notation for (4S)-4-(3-bromo-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one?
The canonical SMILES for (4S)-4-(3-bromo-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one is O=C1N[C@@H](c2ccc(O)c(Br)c2)C(F)(F)CO1.
What is the InChIKey of (4S)-4-(3-bromo-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one?
The InChIKey is XZESPHGGSWTTOZ-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H8BrF2NO3/c11-6-3-5(1-2-7(6)15)8-10(12,13)4-17-9(16)14-8/h1-3,8,15H,4H2,(H,14,16)/t8-/m0/s1.
What are the key properties of (4S)-4-(3-bromo-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one?
(4S)-4-(3-bromo-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one has a molecular weight of 308.08 g/mol, XLogP of 2.57, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(3-bromo-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one is sourced from PubChem (CID 171186589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).