C10H6ClF4NO2 — CID 171186937
(4S)-4-(3-chloro-2,6-difluorophenyl)-5,5-difluoro-1,3-oxazinan-2-one (PubChem CID 171186937) has the molecular formula C10H6ClF4NO2 and a molecular weight of 283.61 g/mol. Its IUPAC name is (4S)-4-(3-chloro-2,6-difluorophenyl)-5,5-difluoro-1,3-oxazinan-2-one.
| Compound Name | (4S)-4-(3-chloro-2,6-difluorophenyl)-5,5-difluoro-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171186937 |
| Molecular Formula | C10H6ClF4NO2 |
| Molecular Weight | 283.61 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | (4S)-4-(3-chloro-2,6-difluorophenyl)-5,5-difluoro-1,3-oxazinan-2-one |
| SMILES | O=C1N[C@@H](c2c(F)ccc(Cl)c2F)C(F)(F)CO1 |
| InChI | InChI=1S/C10H6ClF4NO2/c11-4-1-2-5(12)6(7(4)13)8-10(14,15)3-18-9(17)16-8/h1-2,8H,3H2,(H,16,17)/t8-/m0/s1 |
| InChIKey | MGZZNVGIJHXLCJ-QMMMGPOBSA-N |
| XLogP | 3.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.61 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|