About [4-[(4S)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]phenyl] acetate
[4-[(4S)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]phenyl] acetate (PubChem CID 171186983) has the molecular formula C12H11F2NO4
and a molecular weight of 271.22 g/mol. Its IUPAC name is [4-[(4S)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]phenyl] acetate.
Molecular Properties
| Compound Name | [4-[(4S)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]phenyl] acetate |
| PubChem CID | 171186983 |
| Molecular Formula | C12H11F2NO4 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | [4-[(4S)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@@H]2NC(=O)OCC2(F)F)cc1 |
| InChI | InChI=1S/C12H11F2NO4/c1-7(16)19-9-4-2-8(3-5-9)10-12(13,14)6-18-11(17)15-10/h2-5,10H,6H2,1H3,(H,15,17)/t10-/m0/s1 |
| InChIKey | IGZNNPSIBQEGPR-JTQLQIEISA-N |
| XLogP | 2.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(4S)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4S)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]phenyl] acetate?
The IUPAC name of [4-[(4S)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]phenyl] acetate (CID 171186983) is [4-[(4S)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]phenyl] acetate.
What is the SMILES notation for [4-[(4S)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]phenyl] acetate?
The canonical SMILES for [4-[(4S)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]phenyl] acetate is CC(=O)Oc1ccc([C@@H]2NC(=O)OCC2(F)F)cc1.
What is the InChIKey of [4-[(4S)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]phenyl] acetate?
The InChIKey is IGZNNPSIBQEGPR-JTQLQIEISA-N. The full InChI is InChI=1S/C12H11F2NO4/c1-7(16)19-9-4-2-8(3-5-9)10-12(13,14)6-18-11(17)15-10/h2-5,10H,6H2,1H3,(H,15,17)/t10-/m0/s1.
What are the key properties of [4-[(4S)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]phenyl] acetate?
[4-[(4S)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]phenyl] acetate has a molecular weight of 271.22 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4S)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]phenyl] acetate is sourced from PubChem (CID 171186983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).