C12H13F2NO2 — CID 171187237
(4S)-4-(2,4-dimethylphenyl)-5,5-difluoro-1,3-oxazinan-2-one (PubChem CID 171187237) has the molecular formula C12H13F2NO2 and a molecular weight of 241.24 g/mol. Its IUPAC name is (4S)-4-(2,4-dimethylphenyl)-5,5-difluoro-1,3-oxazinan-2-one.
| Compound Name | (4S)-4-(2,4-dimethylphenyl)-5,5-difluoro-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171187237 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | (4S)-4-(2,4-dimethylphenyl)-5,5-difluoro-1,3-oxazinan-2-one |
| SMILES | Cc1ccc([C@@H]2NC(=O)OCC2(F)F)c(C)c1 |
| InChI | InChI=1S/C12H13F2NO2/c1-7-3-4-9(8(2)5-7)10-12(13,14)6-17-11(16)15-10/h3-5,10H,6H2,1-2H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | IKQJUBMZEMDCQL-JTQLQIEISA-N |
| XLogP | 2.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |