C27H33N3O3 — CID 17118726
N-(2-butan-2-ylphenyl)-1-(5-oxo-1-phenylpyrrolidine-3-carbonyl)piperidine-4-carboxamide (PubChem CID 17118726) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-(2-butan-2-ylphenyl)-1-(5-oxo-1-phenylpyrrolidine-3-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(2-butan-2-ylphenyl)-1-(5-oxo-1-phenylpyrrolidine-3-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17118726 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | N-(2-butan-2-ylphenyl)-1-(5-oxo-1-phenylpyrrolidine-3-carbonyl)piperidine-4-carboxamide |
| SMILES | CCC(C)c1ccccc1NC(=O)C1CCN(C(=O)C2CC(=O)N(c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C27H33N3O3/c1-3-19(2)23-11-7-8-12-24(23)28-26(32)20-13-15-29(16-14-20)27(33)21-17-25(31)30(18-21)22-9-5-4-6-10-22/h4-12,19-21H,3,13-18H2,1-2H3,(H,28,32) |
| InChIKey | LUWVPGZXOJLLAF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |