About (4S)-5,5-dimethyl-4-(3-phenylphenyl)-1,3-oxazinan-2-one;hydrochloride
(4S)-5,5-dimethyl-4-(3-phenylphenyl)-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171187376) has the molecular formula C18H20ClNO2
and a molecular weight of 317.82 g/mol. Its IUPAC name is (4S)-5,5-dimethyl-4-(3-phenylphenyl)-1,3-oxazinan-2-one;hydrochloride.
Molecular Properties
| Compound Name | (4S)-5,5-dimethyl-4-(3-phenylphenyl)-1,3-oxazinan-2-one;hydrochloride |
| PubChem CID | 171187376 |
| Molecular Formula | C18H20ClNO2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (4S)-5,5-dimethyl-4-(3-phenylphenyl)-1,3-oxazinan-2-one;hydrochloride |
| SMILES | CC1(C)COC(=O)N[C@H]1c1cccc(-c2ccccc2)c1.Cl |
| InChI | InChI=1S/C18H19NO2.ClH/c1-18(2)12-21-17(20)19-16(18)15-10-6-9-14(11-15)13-7-4-3-5-8-13;/h3-11,16H,12H2,1-2H3,(H,19,20);1H/t16-;/m0./s1 |
| InChIKey | HRQTXALYTRPUJV-NTISSMGPSA-N |
| XLogP | 4.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-5,5-dimethyl-4-(3-phenylphenyl)-1,3-oxazinan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-5,5-dimethyl-4-(3-phenylphenyl)-1,3-oxazinan-2-one;hydrochloride?
The IUPAC name of (4S)-5,5-dimethyl-4-(3-phenylphenyl)-1,3-oxazinan-2-one;hydrochloride (CID 171187376) is (4S)-5,5-dimethyl-4-(3-phenylphenyl)-1,3-oxazinan-2-one;hydrochloride.
What is the SMILES notation for (4S)-5,5-dimethyl-4-(3-phenylphenyl)-1,3-oxazinan-2-one;hydrochloride?
The canonical SMILES for (4S)-5,5-dimethyl-4-(3-phenylphenyl)-1,3-oxazinan-2-one;hydrochloride is CC1(C)COC(=O)N[C@H]1c1cccc(-c2ccccc2)c1.Cl.
What is the InChIKey of (4S)-5,5-dimethyl-4-(3-phenylphenyl)-1,3-oxazinan-2-one;hydrochloride?
The InChIKey is HRQTXALYTRPUJV-NTISSMGPSA-N. The full InChI is InChI=1S/C18H19NO2.ClH/c1-18(2)12-21-17(20)19-16(18)15-10-6-9-14(11-15)13-7-4-3-5-8-13;/h3-11,16H,12H2,1-2H3,(H,19,20);1H/t16-;/m0./s1.
What are the key properties of (4S)-5,5-dimethyl-4-(3-phenylphenyl)-1,3-oxazinan-2-one;hydrochloride?
(4S)-5,5-dimethyl-4-(3-phenylphenyl)-1,3-oxazinan-2-one;hydrochloride has a molecular weight of 317.82 g/mol, XLogP of 4.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-5,5-dimethyl-4-(3-phenylphenyl)-1,3-oxazinan-2-one;hydrochloride is sourced from PubChem (CID 171187376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).