C12H16ClNO5 — CID 171187522
(4R)-5,5-dimethyl-4-(2,4,6-trihydroxyphenyl)-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171187522) has the molecular formula C12H16ClNO5 and a molecular weight of 289.71 g/mol. Its IUPAC name is (4R)-5,5-dimethyl-4-(2,4,6-trihydroxyphenyl)-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4R)-5,5-dimethyl-4-(2,4,6-trihydroxyphenyl)-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171187522 |
| Molecular Formula | C12H16ClNO5 |
| Molecular Weight | 289.71 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | (4R)-5,5-dimethyl-4-(2,4,6-trihydroxyphenyl)-1,3-oxazinan-2-one;hydrochloride |
| SMILES | CC1(C)COC(=O)N[C@H]1c1c(O)cc(O)cc1O.Cl |
| InChI | InChI=1S/C12H15NO5.ClH/c1-12(2)5-18-11(17)13-10(12)9-7(15)3-6(14)4-8(9)16;/h3-4,10,14-16H,5H2,1-2H3,(H,13,17);1H/t10-;/m0./s1 |
| InChIKey | JEPCOQOJMNJIOX-PPHPATTJSA-N |
| XLogP | 2.03 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.71 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|