C18H25F2NO3 — CID 171187523
(4R)-4-(3,5-ditert-butyl-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one (PubChem CID 171187523) has the molecular formula C18H25F2NO3 and a molecular weight of 341.40 g/mol. Its IUPAC name is (4R)-4-(3,5-ditert-butyl-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one.
| Compound Name | (4R)-4-(3,5-ditert-butyl-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171187523 |
| Molecular Formula | C18H25F2NO3 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (4R)-4-(3,5-ditert-butyl-4-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one |
| SMILES | CC(C)(C)c1cc([C@H]2NC(=O)OCC2(F)F)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C18H25F2NO3/c1-16(2,3)11-7-10(8-12(13(11)22)17(4,5)6)14-18(19,20)9-24-15(23)21-14/h7-8,14,22H,9H2,1-6H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | DYJZIQUUBWSBMM-CQSZACIVSA-N |
| XLogP | 4.40 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |