C14H13F6NO2 — CID 171187555
(4R)-4-[3,5-bis(trifluoromethyl)phenyl]-5,5-dimethyl-1,3-oxazinan-2-one (PubChem CID 171187555) has the molecular formula C14H13F6NO2 and a molecular weight of 341.25 g/mol. Its IUPAC name is (4R)-4-[3,5-bis(trifluoromethyl)phenyl]-5,5-dimethyl-1,3-oxazinan-2-one.
| Compound Name | (4R)-4-[3,5-bis(trifluoromethyl)phenyl]-5,5-dimethyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171187555 |
| Molecular Formula | C14H13F6NO2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (4R)-4-[3,5-bis(trifluoromethyl)phenyl]-5,5-dimethyl-1,3-oxazinan-2-one |
| SMILES | CC1(C)COC(=O)N[C@@H]1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H13F6NO2/c1-12(2)6-23-11(22)21-10(12)7-3-8(13(15,16)17)5-9(4-7)14(18,19)20/h3-5,10H,6H2,1-2H3,(H,21,22)/t10-/m1/s1 |
| InChIKey | GVFUITKMKXIXKN-SNVBAGLBSA-N |
| XLogP | 4.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |