C13H18ClNO4 — CID 171187768
(4S)-4-(2-hydroxy-4-methoxyphenyl)-5,5-dimethyl-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171187768) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is (4S)-4-(2-hydroxy-4-methoxyphenyl)-5,5-dimethyl-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4S)-4-(2-hydroxy-4-methoxyphenyl)-5,5-dimethyl-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171187768 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | (4S)-4-(2-hydroxy-4-methoxyphenyl)-5,5-dimethyl-1,3-oxazinan-2-one;hydrochloride |
| SMILES | COc1ccc([C@H]2NC(=O)OCC2(C)C)c(O)c1.Cl |
| InChI | InChI=1S/C13H17NO4.ClH/c1-13(2)7-18-12(16)14-11(13)9-5-4-8(17-3)6-10(9)15;/h4-6,11,15H,7H2,1-3H3,(H,14,16);1H/t11-;/m1./s1 |
| InChIKey | NDDCVXSEHCYLML-RFVHGSKJSA-N |
| XLogP | 2.63 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|