C10H9F2NO4 — CID 171187785
(4R)-4-(2,5-dihydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one (PubChem CID 171187785) has the molecular formula C10H9F2NO4 and a molecular weight of 245.18 g/mol. Its IUPAC name is (4R)-4-(2,5-dihydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one.
| Compound Name | (4R)-4-(2,5-dihydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171187785 |
| Molecular Formula | C10H9F2NO4 |
| Molecular Weight | 245.18 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | (4R)-4-(2,5-dihydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one |
| SMILES | O=C1N[C@H](c2cc(O)ccc2O)C(F)(F)CO1 |
| InChI | InChI=1S/C10H9F2NO4/c11-10(12)4-17-9(16)13-8(10)6-3-5(14)1-2-7(6)15/h1-3,8,14-15H,4H2,(H,13,16)/t8-/m1/s1 |
| InChIKey | ZONQHNBBBROZLJ-MRVPVSSYSA-N |
| XLogP | 1.51 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|