C19H23ClN2O2 — CID 171187856
(4R)-4-[4-(benzylamino)phenyl]-5,5-dimethyl-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171187856) has the molecular formula C19H23ClN2O2 and a molecular weight of 346.86 g/mol. Its IUPAC name is (4R)-4-[4-(benzylamino)phenyl]-5,5-dimethyl-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4R)-4-[4-(benzylamino)phenyl]-5,5-dimethyl-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171187856 |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (4R)-4-[4-(benzylamino)phenyl]-5,5-dimethyl-1,3-oxazinan-2-one;hydrochloride |
| SMILES | CC1(C)COC(=O)N[C@@H]1c1ccc(NCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C19H22N2O2.ClH/c1-19(2)13-23-18(22)21-17(19)15-8-10-16(11-9-15)20-12-14-6-4-3-5-7-14;/h3-11,17,20H,12-13H2,1-2H3,(H,21,22);1H/t17-;/m1./s1 |
| InChIKey | KJCQINUSYXYFNC-UNTBIKODSA-N |
| XLogP | 4.53 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |