C11H10BrF2NO2 — CID 171187987
(4R)-4-(3-bromo-4-methylphenyl)-5,5-difluoro-1,3-oxazinan-2-one (PubChem CID 171187987) has the molecular formula C11H10BrF2NO2 and a molecular weight of 306.11 g/mol. Its IUPAC name is (4R)-4-(3-bromo-4-methylphenyl)-5,5-difluoro-1,3-oxazinan-2-one.
| Compound Name | (4R)-4-(3-bromo-4-methylphenyl)-5,5-difluoro-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171187987 |
| Molecular Formula | C11H10BrF2NO2 |
| Molecular Weight | 306.11 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | (4R)-4-(3-bromo-4-methylphenyl)-5,5-difluoro-1,3-oxazinan-2-one |
| SMILES | Cc1ccc([C@H]2NC(=O)OCC2(F)F)cc1Br |
| InChI | InChI=1S/C11H10BrF2NO2/c1-6-2-3-7(4-8(6)12)9-11(13,14)5-17-10(16)15-9/h2-4,9H,5H2,1H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | JCAVGVCDRIOEAW-SECBINFHSA-N |
| XLogP | 3.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.11 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |