C12H11F4NO2 — CID 171188505
(4S)-5,5-dimethyl-4-(2,3,5,6-tetrafluorophenyl)-1,3-oxazinan-2-one (PubChem CID 171188505) has the molecular formula C12H11F4NO2 and a molecular weight of 277.22 g/mol. Its IUPAC name is (4S)-5,5-dimethyl-4-(2,3,5,6-tetrafluorophenyl)-1,3-oxazinan-2-one.
| Compound Name | (4S)-5,5-dimethyl-4-(2,3,5,6-tetrafluorophenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171188505 |
| Molecular Formula | C12H11F4NO2 |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | (4S)-5,5-dimethyl-4-(2,3,5,6-tetrafluorophenyl)-1,3-oxazinan-2-one |
| SMILES | CC1(C)COC(=O)N[C@@H]1c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C12H11F4NO2/c1-12(2)4-19-11(18)17-10(12)7-8(15)5(13)3-6(14)9(7)16/h3,10H,4H2,1-2H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | HOXBEHRLDPTHFY-SNVBAGLBSA-N |
| XLogP | 3.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|