C23H39N3O3 — CID 17118971
1-(1-tert-butyl-5-oxopyrrolidine-3-carbonyl)-N-cyclohexyl-N-ethylpiperidine-4-carboxamide (PubChem CID 17118971) has the molecular formula C23H39N3O3 and a molecular weight of 405.58 g/mol. Its IUPAC name is 1-(1-tert-butyl-5-oxopyrrolidine-3-carbonyl)-N-cyclohexyl-N-ethylpiperidine-4-carboxamide.
| Compound Name | 1-(1-tert-butyl-5-oxopyrrolidine-3-carbonyl)-N-cyclohexyl-N-ethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 17118971 |
| Molecular Formula | C23H39N3O3 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | 1-(1-tert-butyl-5-oxopyrrolidine-3-carbonyl)-N-cyclohexyl-N-ethylpiperidine-4-carboxamide |
| SMILES | CCN(C(=O)C1CCN(C(=O)C2CC(=O)N(C(C)(C)C)C2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C23H39N3O3/c1-5-25(19-9-7-6-8-10-19)22(29)17-11-13-24(14-12-17)21(28)18-15-20(27)26(16-18)23(2,3)4/h17-19H,5-16H2,1-4H3 |
| InChIKey | MOTRDQLYTXSLPH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |