C8H15BF3NO2 — CID 171191029
(1R)-2,2,2-trifluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethanamine (PubChem CID 171191029) has the molecular formula C8H15BF3NO2 and a molecular weight of 225.02 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethanamine.
| Compound Name | (1R)-2,2,2-trifluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethanamine |
|---|---|
| PubChem CID | 171191029 |
| Molecular Formula | C8H15BF3NO2 |
| Molecular Weight | 225.02 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethanamine |
| SMILES | CC1(C)OB([C@@H](N)C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C8H15BF3NO2/c1-6(2)7(3,4)15-9(14-6)5(13)8(10,11)12/h5H,13H2,1-4H3/t5-/m0/s1 |
| InChIKey | AOELOQDSNDEOMM-YFKPBYRVSA-N |
| XLogP | 1.51 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.02 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|