C15H21BN2O2 — CID 171191399
(S)-1H-indol-6-yl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine (PubChem CID 171191399) has the molecular formula C15H21BN2O2 and a molecular weight of 272.16 g/mol. Its IUPAC name is (S)-1H-indol-6-yl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine.
| Compound Name | (S)-1H-indol-6-yl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine |
|---|---|
| PubChem CID | 171191399 |
| Molecular Formula | C15H21BN2O2 |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | (S)-1H-indol-6-yl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine |
| SMILES | CC1(C)OB([C@H](N)c2ccc3cc[nH]c3c2)OC1(C)C |
| InChI | InChI=1S/C15H21BN2O2/c1-14(2)15(3,4)20-16(19-14)13(17)11-6-5-10-7-8-18-12(10)9-11/h5-9,13,18H,17H2,1-4H3/t13-/m1/s1 |
| InChIKey | GNWNKRZTJNFCFK-CYBMUJFWSA-N |
| XLogP | 2.80 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|