About (3R)-3-(6-chloro-1,3-benzodioxol-5-yl)morpholine
(3R)-3-(6-chloro-1,3-benzodioxol-5-yl)morpholine (PubChem CID 171192921) has the molecular formula C11H12ClNO3
and a molecular weight of 241.67 g/mol. Its IUPAC name is (3R)-3-(6-chloro-1,3-benzodioxol-5-yl)morpholine.
Molecular Properties
| Compound Name | (3R)-3-(6-chloro-1,3-benzodioxol-5-yl)morpholine |
| PubChem CID | 171192921 |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | (3R)-3-(6-chloro-1,3-benzodioxol-5-yl)morpholine |
| SMILES | Clc1cc2c(cc1[C@@H]1COCCN1)OCO2 |
| InChI | InChI=1S/C11H12ClNO3/c12-8-4-11-10(15-6-16-11)3-7(8)9-5-14-2-1-13-9/h3-4,9,13H,1-2,5-6H2/t9-/m0/s1 |
| InChIKey | BVWRUMSKAGYLGS-VIFPVBQESA-N |
| XLogP | 1.73 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-3-(6-chloro-1,3-benzodioxol-5-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(6-chloro-1,3-benzodioxol-5-yl)morpholine?
The IUPAC name of (3R)-3-(6-chloro-1,3-benzodioxol-5-yl)morpholine (CID 171192921) is (3R)-3-(6-chloro-1,3-benzodioxol-5-yl)morpholine.
What is the SMILES notation for (3R)-3-(6-chloro-1,3-benzodioxol-5-yl)morpholine?
The canonical SMILES for (3R)-3-(6-chloro-1,3-benzodioxol-5-yl)morpholine is Clc1cc2c(cc1[C@@H]1COCCN1)OCO2.
What is the InChIKey of (3R)-3-(6-chloro-1,3-benzodioxol-5-yl)morpholine?
The InChIKey is BVWRUMSKAGYLGS-VIFPVBQESA-N. The full InChI is InChI=1S/C11H12ClNO3/c12-8-4-11-10(15-6-16-11)3-7(8)9-5-14-2-1-13-9/h3-4,9,13H,1-2,5-6H2/t9-/m0/s1.
What are the key properties of (3R)-3-(6-chloro-1,3-benzodioxol-5-yl)morpholine?
(3R)-3-(6-chloro-1,3-benzodioxol-5-yl)morpholine has a molecular weight of 241.67 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(6-chloro-1,3-benzodioxol-5-yl)morpholine is sourced from PubChem (CID 171192921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).