C12H18ClNO — CID 171193047
(3S)-3-(3,4-dimethylphenyl)morpholine;hydrochloride (PubChem CID 171193047) has the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. Its IUPAC name is (3S)-3-(3,4-dimethylphenyl)morpholine;hydrochloride.
| Compound Name | (3S)-3-(3,4-dimethylphenyl)morpholine;hydrochloride |
|---|---|
| PubChem CID | 171193047 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (3S)-3-(3,4-dimethylphenyl)morpholine;hydrochloride |
| SMILES | Cc1ccc([C@H]2COCCN2)cc1C.Cl |
| InChI | InChI=1S/C12H17NO.ClH/c1-9-3-4-11(7-10(9)2)12-8-14-6-5-13-12;/h3-4,7,12-13H,5-6,8H2,1-2H3;1H/t12-;/m1./s1 |
| InChIKey | KCIGSBZHHYPXFX-UTONKHPSSA-N |
| XLogP | 2.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |