About 4-[(2R)-azetidin-2-yl]-3-chloro-N,N-dimethylaniline;hydrochloride
4-[(2R)-azetidin-2-yl]-3-chloro-N,N-dimethylaniline;hydrochloride (PubChem CID 171197440) has the molecular formula C11H16Cl2N2
and a molecular weight of 247.17 g/mol. Its IUPAC name is 4-[(2R)-azetidin-2-yl]-3-chloro-N,N-dimethylaniline;hydrochloride.
Molecular Properties
| Compound Name | 4-[(2R)-azetidin-2-yl]-3-chloro-N,N-dimethylaniline;hydrochloride |
| PubChem CID | 171197440 |
| Molecular Formula | C11H16Cl2N2 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 4-[(2R)-azetidin-2-yl]-3-chloro-N,N-dimethylaniline;hydrochloride |
| SMILES | CN(C)c1ccc([C@H]2CCN2)c(Cl)c1.Cl |
| InChI | InChI=1S/C11H15ClN2.ClH/c1-14(2)8-3-4-9(10(12)7-8)11-5-6-13-11;/h3-4,7,11,13H,5-6H2,1-2H3;1H/t11-;/m1./s1 |
| InChIKey | VGBKYBLLCVJWEE-RFVHGSKJSA-N |
| XLogP | 2.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R)-azetidin-2-yl]-3-chloro-N,N-dimethylaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R)-azetidin-2-yl]-3-chloro-N,N-dimethylaniline;hydrochloride?
The IUPAC name of 4-[(2R)-azetidin-2-yl]-3-chloro-N,N-dimethylaniline;hydrochloride (CID 171197440) is 4-[(2R)-azetidin-2-yl]-3-chloro-N,N-dimethylaniline;hydrochloride.
What is the SMILES notation for 4-[(2R)-azetidin-2-yl]-3-chloro-N,N-dimethylaniline;hydrochloride?
The canonical SMILES for 4-[(2R)-azetidin-2-yl]-3-chloro-N,N-dimethylaniline;hydrochloride is CN(C)c1ccc([C@H]2CCN2)c(Cl)c1.Cl.
What is the InChIKey of 4-[(2R)-azetidin-2-yl]-3-chloro-N,N-dimethylaniline;hydrochloride?
The InChIKey is VGBKYBLLCVJWEE-RFVHGSKJSA-N. The full InChI is InChI=1S/C11H15ClN2.ClH/c1-14(2)8-3-4-9(10(12)7-8)11-5-6-13-11;/h3-4,7,11,13H,5-6H2,1-2H3;1H/t11-;/m1./s1.
What are the key properties of 4-[(2R)-azetidin-2-yl]-3-chloro-N,N-dimethylaniline;hydrochloride?
4-[(2R)-azetidin-2-yl]-3-chloro-N,N-dimethylaniline;hydrochloride has a molecular weight of 247.17 g/mol, XLogP of 2.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-azetidin-2-yl]-3-chloro-N,N-dimethylaniline;hydrochloride is sourced from PubChem (CID 171197440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).