C9H11Cl2F3N2 — CID 171198796
(1R)-1-(6-chloro-3-pyridinyl)-4,4,4-trifluorobutan-1-amine;hydrochloride (PubChem CID 171198796) has the molecular formula C9H11Cl2F3N2 and a molecular weight of 275.10 g/mol. Its IUPAC name is (1R)-1-(6-chloro-3-pyridinyl)-4,4,4-trifluorobutan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(6-chloro-3-pyridinyl)-4,4,4-trifluorobutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171198796 |
| Molecular Formula | C9H11Cl2F3N2 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | (1R)-1-(6-chloro-3-pyridinyl)-4,4,4-trifluorobutan-1-amine;hydrochloride |
| SMILES | Cl.N[C@H](CCC(F)(F)F)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C9H10ClF3N2.ClH/c10-8-2-1-6(5-15-8)7(14)3-4-9(11,12)13;/h1-2,5,7H,3-4,14H2;1H/t7-;/m1./s1 |
| InChIKey | YKSWRMQEROUDOC-OGFXRTJISA-N |
| XLogP | 3.50 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|