C11H13Br2NO3 — CID 171200015
ethyl (3R)-3-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanoate (PubChem CID 171200015) has the molecular formula C11H13Br2NO3 and a molecular weight of 367.04 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanoate.
| Compound Name | ethyl (3R)-3-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 171200015 |
| Molecular Formula | C11H13Br2NO3 |
| Molecular Weight | 367.04 g/mol |
| Exact Mass | 364.93 |
| IUPAC Name | ethyl (3R)-3-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanoate |
| SMILES | CCOC(=O)C[C@@H](N)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C11H13Br2NO3/c1-2-17-10(15)5-9(14)6-3-7(12)11(16)8(13)4-6/h3-4,9,16H,2,5,14H2,1H3/t9-/m1/s1 |
| InChIKey | RSULLTQXGSGBLW-SECBINFHSA-N |
| XLogP | 2.87 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.04 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |