C12H19BrClNO — CID 171201616
(1R)-1-(5-bromo-2-methoxyphenyl)-2-methylbutan-1-amine;hydrochloride (PubChem CID 171201616) has the molecular formula C12H19BrClNO and a molecular weight of 308.65 g/mol. Its IUPAC name is (1R)-1-(5-bromo-2-methoxyphenyl)-2-methylbutan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(5-bromo-2-methoxyphenyl)-2-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171201616 |
| Molecular Formula | C12H19BrClNO |
| Molecular Weight | 308.65 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | (1R)-1-(5-bromo-2-methoxyphenyl)-2-methylbutan-1-amine;hydrochloride |
| SMILES | CCC(C)[C@@H](N)c1cc(Br)ccc1OC.Cl |
| InChI | InChI=1S/C12H18BrNO.ClH/c1-4-8(2)12(14)10-7-9(13)5-6-11(10)15-3;/h5-8,12H,4,14H2,1-3H3;1H/t8?,12-;/m1./s1 |
| InChIKey | VLYYRQPLVGXBLH-QFBOXNNLSA-N |
| XLogP | 3.93 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |