C10H14BrClFN — CID 171202134
(1R)-1-(2-bromo-4-methylphenyl)-3-fluoropropan-1-amine;hydrochloride (PubChem CID 171202134) has the molecular formula C10H14BrClFN and a molecular weight of 282.58 g/mol. Its IUPAC name is (1R)-1-(2-bromo-4-methylphenyl)-3-fluoropropan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(2-bromo-4-methylphenyl)-3-fluoropropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171202134 |
| Molecular Formula | C10H14BrClFN |
| Molecular Weight | 282.58 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | (1R)-1-(2-bromo-4-methylphenyl)-3-fluoropropan-1-amine;hydrochloride |
| SMILES | Cc1ccc([C@H](N)CCF)c(Br)c1.Cl |
| InChI | InChI=1S/C10H13BrFN.ClH/c1-7-2-3-8(9(11)6-7)10(13)4-5-12;/h2-3,6,10H,4-5,13H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | BJHZRJSKAVPFEB-HNCPQSOCSA-N |
| XLogP | 3.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |