C10H14BrClN2 — CID 171203412
(1R)-1-(6-bromo-2-pyridinyl)pent-4-en-1-amine;hydrochloride (PubChem CID 171203412) has the molecular formula C10H14BrClN2 and a molecular weight of 277.59 g/mol. Its IUPAC name is (1R)-1-(6-bromo-2-pyridinyl)pent-4-en-1-amine;hydrochloride.
| Compound Name | (1R)-1-(6-bromo-2-pyridinyl)pent-4-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171203412 |
| Molecular Formula | C10H14BrClN2 |
| Molecular Weight | 277.59 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | (1R)-1-(6-bromo-2-pyridinyl)pent-4-en-1-amine;hydrochloride |
| SMILES | C=CCC[C@@H](N)c1cccc(Br)n1.Cl |
| InChI | InChI=1S/C10H13BrN2.ClH/c1-2-3-5-8(12)9-6-4-7-10(11)13-9;/h2,4,6-8H,1,3,5,12H2;1H/t8-;/m1./s1 |
| InChIKey | FMJZGUWFMWQFMV-DDWIOCJRSA-N |
| XLogP | 3.23 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|