C12H19FN2 — CID 171204385
(1R)-1-(5-fluoro-2-methylphenyl)pentane-1,5-diamine (PubChem CID 171204385) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is (1R)-1-(5-fluoro-2-methylphenyl)pentane-1,5-diamine.
| Compound Name | (1R)-1-(5-fluoro-2-methylphenyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 171204385 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | (1R)-1-(5-fluoro-2-methylphenyl)pentane-1,5-diamine |
| SMILES | Cc1ccc(F)cc1[C@H](N)CCCCN |
| InChI | InChI=1S/C12H19FN2/c1-9-5-6-10(13)8-11(9)12(15)4-2-3-7-14/h5-6,8,12H,2-4,7,14-15H2,1H3/t12-/m1/s1 |
| InChIKey | QTVMICNMKVXRFJ-GFCCVEGCSA-N |
| XLogP | 2.26 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|