C12H13F2NO2 — CID 171207870
(1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine (PubChem CID 171207870) has the molecular formula C12H13F2NO2 and a molecular weight of 241.24 g/mol. Its IUPAC name is (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine.
| Compound Name | (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 171207870 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine |
| SMILES | C=CCC[C@@H](N)c1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C12H13F2NO2/c1-2-3-6-9(15)8-5-4-7-10-11(8)17-12(13,14)16-10/h2,4-5,7,9H,1,3,6,15H2/t9-/m1/s1 |
| InChIKey | LIQPCFHLTGNKMC-SECBINFHSA-N |
| XLogP | 2.97 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|