About (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine
(1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine (PubChem CID 171207870) has the molecular formula C12H13F2NO2
and a molecular weight of 241.24 g/mol. Its IUPAC name is (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine.
Molecular Properties
| Compound Name | (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine |
| PubChem CID | 171207870 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine |
| SMILES | C=CCC[C@@H](N)c1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C12H13F2NO2/c1-2-3-6-9(15)8-5-4-7-10-11(8)17-12(13,14)16-10/h2,4-5,7,9H,1,3,6,15H2/t9-/m1/s1 |
| InChIKey | LIQPCFHLTGNKMC-SECBINFHSA-N |
| XLogP | 2.97 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine?
The IUPAC name of (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine (CID 171207870) is (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine.
What is the SMILES notation for (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine?
The canonical SMILES for (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine is C=CCC[C@@H](N)c1cccc2c1OC(F)(F)O2.
What is the InChIKey of (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine?
The InChIKey is LIQPCFHLTGNKMC-SECBINFHSA-N. The full InChI is InChI=1S/C12H13F2NO2/c1-2-3-6-9(15)8-5-4-7-10-11(8)17-12(13,14)16-10/h2,4-5,7,9H,1,3,6,15H2/t9-/m1/s1.
What are the key properties of (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine?
(1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine has a molecular weight of 241.24 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)pent-4-en-1-amine is sourced from PubChem (CID 171207870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).