C12H20ClN3 — CID 171211332
3-[(R)-amino(cyclohexyl)methyl]pyridin-2-amine;hydrochloride (PubChem CID 171211332) has the molecular formula C12H20ClN3 and a molecular weight of 241.77 g/mol. Its IUPAC name is 3-[(R)-amino(cyclohexyl)methyl]pyridin-2-amine;hydrochloride.
| Compound Name | 3-[(R)-amino(cyclohexyl)methyl]pyridin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 171211332 |
| Molecular Formula | C12H20ClN3 |
| Molecular Weight | 241.77 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 3-[(R)-amino(cyclohexyl)methyl]pyridin-2-amine;hydrochloride |
| SMILES | Cl.Nc1ncccc1[C@H](N)C1CCCCC1 |
| InChI | InChI=1S/C12H19N3.ClH/c13-11(9-5-2-1-3-6-9)10-7-4-8-15-12(10)14;/h4,7-9,11H,1-3,5-6,13H2,(H2,14,15);1H/t11-;/m1./s1 |
| InChIKey | CYGCUPWOIAXCON-RFVHGSKJSA-N |
| XLogP | 2.67 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.77 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |