About methyl 4-[(1R)-1-aminoprop-2-enyl]benzoate;hydrochloride
methyl 4-[(1R)-1-aminoprop-2-enyl]benzoate;hydrochloride (PubChem CID 171212672) has the molecular formula C11H14ClNO2
and a molecular weight of 227.69 g/mol. Its IUPAC name is methyl 4-[(1R)-1-aminoprop-2-enyl]benzoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 4-[(1R)-1-aminoprop-2-enyl]benzoate;hydrochloride |
| PubChem CID | 171212672 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | methyl 4-[(1R)-1-aminoprop-2-enyl]benzoate;hydrochloride |
| SMILES | C=C[C@@H](N)c1ccc(C(=O)OC)cc1.Cl |
| InChI | InChI=1S/C11H13NO2.ClH/c1-3-10(12)8-4-6-9(7-5-8)11(13)14-2;/h3-7,10H,1,12H2,2H3;1H/t10-;/m1./s1 |
| InChIKey | VCSIVPMAESSQFN-HNCPQSOCSA-N |
| XLogP | 2.08 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(1R)-1-aminoprop-2-enyl]benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(1R)-1-aminoprop-2-enyl]benzoate;hydrochloride?
The IUPAC name of methyl 4-[(1R)-1-aminoprop-2-enyl]benzoate;hydrochloride (CID 171212672) is methyl 4-[(1R)-1-aminoprop-2-enyl]benzoate;hydrochloride.
What is the SMILES notation for methyl 4-[(1R)-1-aminoprop-2-enyl]benzoate;hydrochloride?
The canonical SMILES for methyl 4-[(1R)-1-aminoprop-2-enyl]benzoate;hydrochloride is C=C[C@@H](N)c1ccc(C(=O)OC)cc1.Cl.
What is the InChIKey of methyl 4-[(1R)-1-aminoprop-2-enyl]benzoate;hydrochloride?
The InChIKey is VCSIVPMAESSQFN-HNCPQSOCSA-N. The full InChI is InChI=1S/C11H13NO2.ClH/c1-3-10(12)8-4-6-9(7-5-8)11(13)14-2;/h3-7,10H,1,12H2,2H3;1H/t10-;/m1./s1.
What are the key properties of methyl 4-[(1R)-1-aminoprop-2-enyl]benzoate;hydrochloride?
methyl 4-[(1R)-1-aminoprop-2-enyl]benzoate;hydrochloride has a molecular weight of 227.69 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(1R)-1-aminoprop-2-enyl]benzoate;hydrochloride is sourced from PubChem (CID 171212672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).