C13H20ClN — CID 171213154
(R)-cyclobutyl-(2,4-dimethylphenyl)methanamine;hydrochloride (PubChem CID 171213154) has the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. Its IUPAC name is (R)-cyclobutyl-(2,4-dimethylphenyl)methanamine;hydrochloride.
| Compound Name | (R)-cyclobutyl-(2,4-dimethylphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171213154 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | (R)-cyclobutyl-(2,4-dimethylphenyl)methanamine;hydrochloride |
| SMILES | Cc1ccc([C@H](N)C2CCC2)c(C)c1.Cl |
| InChI | InChI=1S/C13H19N.ClH/c1-9-6-7-12(10(2)8-9)13(14)11-4-3-5-11;/h6-8,11,13H,3-5,14H2,1-2H3;1H/t13-;/m1./s1 |
| InChIKey | OCZMTKXWJWYOEL-BTQNPOSSSA-N |
| XLogP | 3.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |