C13H18ClN3 — CID 171216978
(1R)-1-quinolin-4-ylbutane-1,4-diamine;hydrochloride (PubChem CID 171216978) has the molecular formula C13H18ClN3 and a molecular weight of 251.76 g/mol. Its IUPAC name is (1R)-1-quinolin-4-ylbutane-1,4-diamine;hydrochloride.
| Compound Name | (1R)-1-quinolin-4-ylbutane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171216978 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (1R)-1-quinolin-4-ylbutane-1,4-diamine;hydrochloride |
| SMILES | Cl.NCCC[C@@H](N)c1ccnc2ccccc12 |
| InChI | InChI=1S/C13H17N3.ClH/c14-8-3-5-12(15)10-7-9-16-13-6-2-1-4-11(10)13;/h1-2,4,6-7,9,12H,3,5,8,14-15H2;1H/t12-;/m1./s1 |
| InChIKey | NTHAHQUWQFQNLD-UTONKHPSSA-N |
| XLogP | 2.40 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |