C25H21ClN4O5 — CID 17121734
2-chloro-N-[3-(3,4-dimethoxyphenyl)-2-methyl-3H-1,5-benzodiazepin-4-yl]-3-nitrobenzamide (PubChem CID 17121734) has the molecular formula C25H21ClN4O5 and a molecular weight of 492.92 g/mol. Its IUPAC name is 2-chloro-N-[3-(3,4-dimethoxyphenyl)-2-methyl-3H-1,5-benzodiazepin-4-yl]-3-nitrobenzamide.
| Compound Name | 2-chloro-N-[3-(3,4-dimethoxyphenyl)-2-methyl-3H-1,5-benzodiazepin-4-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 17121734 |
| Molecular Formula | C25H21ClN4O5 |
| Molecular Weight | 492.92 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 2-chloro-N-[3-(3,4-dimethoxyphenyl)-2-methyl-3H-1,5-benzodiazepin-4-yl]-3-nitrobenzamide |
| SMILES | COc1ccc(C2C(C)=Nc3ccccc3N=C2NC(=O)c2cccc([N+](=O)[O-])c2Cl)cc1OC |
| InChI | InChI=1S/C25H21ClN4O5/c1-14-22(15-11-12-20(34-2)21(13-15)35-3)24(28-18-9-5-4-8-17(18)27-14)29-25(31)16-7-6-10-19(23(16)26)30(32)33/h4-13,22H,1-3H3,(H,28,29,31) |
| InChIKey | GTIJDBKBZFCYKO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.92 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|