C10H15BrClNO — CID 171217585
(4S)-4-amino-4-(2-bromophenyl)butan-1-ol;hydrochloride (PubChem CID 171217585) has the molecular formula C10H15BrClNO and a molecular weight of 280.59 g/mol. Its IUPAC name is (4S)-4-amino-4-(2-bromophenyl)butan-1-ol;hydrochloride.
| Compound Name | (4S)-4-amino-4-(2-bromophenyl)butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171217585 |
| Molecular Formula | C10H15BrClNO |
| Molecular Weight | 280.59 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | (4S)-4-amino-4-(2-bromophenyl)butan-1-ol;hydrochloride |
| SMILES | Cl.N[C@@H](CCCO)c1ccccc1Br |
| InChI | InChI=1S/C10H14BrNO.ClH/c11-9-5-2-1-4-8(9)10(12)6-3-7-13;/h1-2,4-5,10,13H,3,6-7,12H2;1H/t10-;/m0./s1 |
| InChIKey | DZBCYVIMLNWYCN-PPHPATTJSA-N |
| XLogP | 2.64 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.59 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |