C14H22ClNO2 — CID 171218788
(S)-cyclopentyl-(2,3-dimethoxyphenyl)methanamine;hydrochloride (PubChem CID 171218788) has the molecular formula C14H22ClNO2 and a molecular weight of 271.79 g/mol. Its IUPAC name is (S)-cyclopentyl-(2,3-dimethoxyphenyl)methanamine;hydrochloride.
| Compound Name | (S)-cyclopentyl-(2,3-dimethoxyphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171218788 |
| Molecular Formula | C14H22ClNO2 |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (S)-cyclopentyl-(2,3-dimethoxyphenyl)methanamine;hydrochloride |
| SMILES | COc1cccc([C@@H](N)C2CCCC2)c1OC.Cl |
| InChI | InChI=1S/C14H21NO2.ClH/c1-16-12-9-5-8-11(14(12)17-2)13(15)10-6-3-4-7-10;/h5,8-10,13H,3-4,6-7,15H2,1-2H3;1H/t13-;/m0./s1 |
| InChIKey | PXIWGDGLFXPRGD-ZOWNYOTGSA-N |
| XLogP | 3.32 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |