C17H14N2O3 — CID 17121937
1'-ethylspiro[3H-1,3-benzoxazine-2,3'-indole]-2',4-dione (PubChem CID 17121937) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 1'-ethylspiro[3H-1,3-benzoxazine-2,3'-indole]-2',4-dione.
| Compound Name | 1'-ethylspiro[3H-1,3-benzoxazine-2,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 17121937 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1'-ethylspiro[3H-1,3-benzoxazine-2,3'-indole]-2',4-dione |
| SMILES | CCN1C(=O)C2(NC(=O)c3ccccc3O2)c2ccccc21 |
| InChI | InChI=1S/C17H14N2O3/c1-2-19-13-9-5-4-8-12(13)17(16(19)21)18-15(20)11-7-3-6-10-14(11)22-17/h3-10H,2H2,1H3,(H,18,20) |
| InChIKey | HCMUGNJYRDQZEK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |