C10H15BrClFN2 — CID 171220445
(1S)-1-(3-bromo-4-fluorophenyl)butane-1,4-diamine;hydrochloride (PubChem CID 171220445) has the molecular formula C10H15BrClFN2 and a molecular weight of 297.60 g/mol. Its IUPAC name is (1S)-1-(3-bromo-4-fluorophenyl)butane-1,4-diamine;hydrochloride.
| Compound Name | (1S)-1-(3-bromo-4-fluorophenyl)butane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171220445 |
| Molecular Formula | C10H15BrClFN2 |
| Molecular Weight | 297.60 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | (1S)-1-(3-bromo-4-fluorophenyl)butane-1,4-diamine;hydrochloride |
| SMILES | Cl.NCCC[C@H](N)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C10H14BrFN2.ClH/c11-8-6-7(3-4-9(8)12)10(14)2-1-5-13;/h3-4,6,10H,1-2,5,13-14H2;1H/t10-;/m0./s1 |
| InChIKey | VIXGVKQFLAKJRR-PPHPATTJSA-N |
| XLogP | 2.75 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.60 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |