C13H9N3O2S — CID 17122068
7-(2-hydroxyphenyl)-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile (PubChem CID 17122068) has the molecular formula C13H9N3O2S and a molecular weight of 271.30 g/mol. Its IUPAC name is 7-(2-hydroxyphenyl)-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile.
| Compound Name | 7-(2-hydroxyphenyl)-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 17122068 |
| Molecular Formula | C13H9N3O2S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 7-(2-hydroxyphenyl)-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2O)nc2n(c1=O)CCS2 |
| InChI | InChI=1S/C13H9N3O2S/c14-7-9-11(8-3-1-2-4-10(8)17)15-13-16(12(9)18)5-6-19-13/h1-4,17H,5-6H2 |
| InChIKey | UDOJBIYFWSYIIC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|