About [2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] acetate
[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] acetate (PubChem CID 17122164) has the molecular formula C12H14N4O2
and a molecular weight of 246.27 g/mol. Its IUPAC name is [2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] acetate.
Molecular Properties
| Compound Name | [2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] acetate |
| PubChem CID | 17122164 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | [2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] acetate |
| SMILES | CC(=O)Oc1cc(C)nn1-c1nc(C)cc(C)n1 |
| InChI | InChI=1S/C12H14N4O2/c1-7-5-8(2)14-12(13-7)16-11(18-10(4)17)6-9(3)15-16/h5-6H,1-4H3 |
| InChIKey | QBFNHGKZNJPZHU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] acetate?
The IUPAC name of [2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] acetate (CID 17122164) is [2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] acetate.
What is the SMILES notation for [2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] acetate?
The canonical SMILES for [2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] acetate is CC(=O)Oc1cc(C)nn1-c1nc(C)cc(C)n1.
What is the InChIKey of [2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] acetate?
The InChIKey is QBFNHGKZNJPZHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2/c1-7-5-8(2)14-12(13-7)16-11(18-10(4)17)6-9(3)15-16/h5-6H,1-4H3.
What are the key properties of [2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] acetate?
[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] acetate has a molecular weight of 246.27 g/mol, XLogP of 1.51, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] acetate is sourced from PubChem (CID 17122164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).