C13H14BrNO2S — CID 171221826
(R)-(4-bromo-3,5-dimethoxyphenyl)-thiophen-2-ylmethanamine (PubChem CID 171221826) has the molecular formula C13H14BrNO2S and a molecular weight of 328.23 g/mol. Its IUPAC name is (R)-(4-bromo-3,5-dimethoxyphenyl)-thiophen-2-ylmethanamine.
| Compound Name | (R)-(4-bromo-3,5-dimethoxyphenyl)-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 171221826 |
| Molecular Formula | C13H14BrNO2S |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | (R)-(4-bromo-3,5-dimethoxyphenyl)-thiophen-2-ylmethanamine |
| SMILES | COc1cc([C@@H](N)c2cccs2)cc(OC)c1Br |
| InChI | InChI=1S/C13H14BrNO2S/c1-16-9-6-8(7-10(17-2)12(9)14)13(15)11-4-3-5-18-11/h3-7,13H,15H2,1-2H3/t13-/m1/s1 |
| InChIKey | WMVWKWMXNRTYMA-CYBMUJFWSA-N |
| XLogP | 3.58 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |