C12H14ClF4N — CID 171222160
(1S)-2-cyclopropyl-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethanamine;hydrochloride (PubChem CID 171222160) has the molecular formula C12H14ClF4N and a molecular weight of 283.70 g/mol. Its IUPAC name is (1S)-2-cyclopropyl-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethanamine;hydrochloride.
| Compound Name | (1S)-2-cyclopropyl-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171222160 |
| Molecular Formula | C12H14ClF4N |
| Molecular Weight | 283.70 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (1S)-2-cyclopropyl-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](CC1CC1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F4N.ClH/c13-10-4-3-8(6-9(10)12(14,15)16)11(17)5-7-1-2-7;/h3-4,6-7,11H,1-2,5,17H2;1H/t11-;/m0./s1 |
| InChIKey | RBVOCBUMXZHDFZ-MERQFXBCSA-N |
| XLogP | 4.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.70 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |