C16H16F3N — CID 171228019
(1S)-4,4,4-trifluoro-1-(4-phenylphenyl)butan-1-amine (PubChem CID 171228019) has the molecular formula C16H16F3N and a molecular weight of 279.31 g/mol. Its IUPAC name is (1S)-4,4,4-trifluoro-1-(4-phenylphenyl)butan-1-amine.
| Compound Name | (1S)-4,4,4-trifluoro-1-(4-phenylphenyl)butan-1-amine |
|---|---|
| PubChem CID | 171228019 |
| Molecular Formula | C16H16F3N |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (1S)-4,4,4-trifluoro-1-(4-phenylphenyl)butan-1-amine |
| SMILES | N[C@@H](CCC(F)(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H16F3N/c17-16(18,19)11-10-15(20)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9,15H,10-11,20H2/t15-/m0/s1 |
| InChIKey | IMTUHCRFAWWJTM-HNNXBMFYSA-N |
| XLogP | 4.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |