C11H10F5N — CID 171229918
(1S)-1-(2,3,4,5,6-pentafluorophenyl)pent-4-en-1-amine (PubChem CID 171229918) has the molecular formula C11H10F5N and a molecular weight of 251.20 g/mol. Its IUPAC name is (1S)-1-(2,3,4,5,6-pentafluorophenyl)pent-4-en-1-amine.
| Compound Name | (1S)-1-(2,3,4,5,6-pentafluorophenyl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 171229918 |
| Molecular Formula | C11H10F5N |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | (1S)-1-(2,3,4,5,6-pentafluorophenyl)pent-4-en-1-amine |
| SMILES | C=CCC[C@H](N)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H10F5N/c1-2-3-4-5(17)6-7(12)9(14)11(16)10(15)8(6)13/h2,5H,1,3-4,17H2/t5-/m0/s1 |
| InChIKey | DJGGZLMTZIWATL-YFKPBYRVSA-N |
| XLogP | 3.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|