C13H20ClNO — CID 171230366
(1S)-1-(4-propan-2-yloxyphenyl)but-3-en-1-amine;hydrochloride (PubChem CID 171230366) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is (1S)-1-(4-propan-2-yloxyphenyl)but-3-en-1-amine;hydrochloride.
| Compound Name | (1S)-1-(4-propan-2-yloxyphenyl)but-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171230366 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | (1S)-1-(4-propan-2-yloxyphenyl)but-3-en-1-amine;hydrochloride |
| SMILES | C=CC[C@H](N)c1ccc(OC(C)C)cc1.Cl |
| InChI | InChI=1S/C13H19NO.ClH/c1-4-5-13(14)11-6-8-12(9-7-11)15-10(2)3;/h4,6-10,13H,1,5,14H2,2-3H3;1H/t13-;/m0./s1 |
| InChIKey | XSKRBNSGLRTHKJ-ZOWNYOTGSA-N |
| XLogP | 3.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|