C13H21NO2 — CID 171231269
(4S)-4-amino-4-(4-methoxy-3,5-dimethylphenyl)butan-1-ol (PubChem CID 171231269) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is (4S)-4-amino-4-(4-methoxy-3,5-dimethylphenyl)butan-1-ol.
| Compound Name | (4S)-4-amino-4-(4-methoxy-3,5-dimethylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 171231269 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | (4S)-4-amino-4-(4-methoxy-3,5-dimethylphenyl)butan-1-ol |
| SMILES | COc1c(C)cc([C@@H](N)CCCO)cc1C |
| InChI | InChI=1S/C13H21NO2/c1-9-7-11(12(14)5-4-6-15)8-10(2)13(9)16-3/h7-8,12,15H,4-6,14H2,1-3H3/t12-/m0/s1 |
| InChIKey | SKVCJHNVGMNIFG-LBPRGKRZSA-N |
| XLogP | 2.08 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |