C26H28N2O5S — CID 17123746
2-(2-ethoxyethoxy)-N-[[3-(2-phenoxyethoxy)phenyl]carbamothioyl]benzamide (PubChem CID 17123746) has the molecular formula C26H28N2O5S and a molecular weight of 480.59 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)-N-[[3-(2-phenoxyethoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-(2-ethoxyethoxy)-N-[[3-(2-phenoxyethoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17123746 |
| Molecular Formula | C26H28N2O5S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 2-(2-ethoxyethoxy)-N-[[3-(2-phenoxyethoxy)phenyl]carbamothioyl]benzamide |
| SMILES | CCOCCOc1ccccc1C(=O)NC(=S)Nc1cccc(OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C26H28N2O5S/c1-2-30-15-16-33-24-14-7-6-13-23(24)25(29)28-26(34)27-20-9-8-12-22(19-20)32-18-17-31-21-10-4-3-5-11-21/h3-14,19H,2,15-18H2,1H3,(H2,27,28,29,34) |
| InChIKey | PDIYBDHAYCEVHZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|