About 2-methoxyethyl 2-[1-[4-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate
2-methoxyethyl 2-[1-[4-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17123814) has the molecular formula C20H26N2O6
and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-methoxyethyl 2-[1-[4-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate.
Molecular Properties
| Compound Name | 2-methoxyethyl 2-[1-[4-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate |
| PubChem CID | 17123814 |
| Molecular Formula | C20H26N2O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-methoxyethyl 2-[1-[4-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | C=C(C)COc1ccc(C(=O)N2CCNC(=O)C2CC(=O)OCCOC)cc1 |
| InChI | InChI=1S/C20H26N2O6/c1-14(2)13-28-16-6-4-15(5-7-16)20(25)22-9-8-21-19(24)17(22)12-18(23)27-11-10-26-3/h4-7,17H,1,8-13H2,2-3H3,(H,21,24) |
| InChIKey | CPNRSSMEDGQXDX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl 2-[1-[4-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl 2-[1-[4-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate?
The IUPAC name of 2-methoxyethyl 2-[1-[4-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate (CID 17123814) is 2-methoxyethyl 2-[1-[4-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate.
What is the SMILES notation for 2-methoxyethyl 2-[1-[4-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate?
The canonical SMILES for 2-methoxyethyl 2-[1-[4-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate is C=C(C)COc1ccc(C(=O)N2CCNC(=O)C2CC(=O)OCCOC)cc1.
What is the InChIKey of 2-methoxyethyl 2-[1-[4-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate?
The InChIKey is CPNRSSMEDGQXDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O6/c1-14(2)13-28-16-6-4-15(5-7-16)20(25)22-9-8-21-19(24)17(22)12-18(23)27-11-10-26-3/h4-7,17H,1,8-13H2,2-3H3,(H,21,24).
What are the key properties of 2-methoxyethyl 2-[1-[4-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate?
2-methoxyethyl 2-[1-[4-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate has a molecular weight of 390.44 g/mol, XLogP of 1.16, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl 2-[1-[4-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate is sourced from PubChem (CID 17123814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).