About (1R)-2,2,2-trifluoro-1-(6-methyl-2-pyridinyl)ethanamine;hydrochloride
(1R)-2,2,2-trifluoro-1-(6-methyl-2-pyridinyl)ethanamine;hydrochloride (PubChem CID 171243254) has the molecular formula C8H10ClF3N2
and a molecular weight of 226.63 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(6-methyl-2-pyridinyl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | (1R)-2,2,2-trifluoro-1-(6-methyl-2-pyridinyl)ethanamine;hydrochloride |
| PubChem CID | 171243254 |
| Molecular Formula | C8H10ClF3N2 |
| Molecular Weight | 226.63 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(6-methyl-2-pyridinyl)ethanamine;hydrochloride |
| SMILES | Cc1cccc([C@@H](N)C(F)(F)F)n1.Cl |
| InChI | InChI=1S/C8H9F3N2.ClH/c1-5-3-2-4-6(13-5)7(12)8(9,10)11;/h2-4,7H,12H2,1H3;1H/t7-;/m1./s1 |
| InChIKey | LDSCKDUYXBDJTC-OGFXRTJISA-N |
| XLogP | 2.37 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.63 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-2,2,2-trifluoro-1-(6-methyl-2-pyridinyl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2,2,2-trifluoro-1-(6-methyl-2-pyridinyl)ethanamine;hydrochloride?
The IUPAC name of (1R)-2,2,2-trifluoro-1-(6-methyl-2-pyridinyl)ethanamine;hydrochloride (CID 171243254) is (1R)-2,2,2-trifluoro-1-(6-methyl-2-pyridinyl)ethanamine;hydrochloride.
What is the SMILES notation for (1R)-2,2,2-trifluoro-1-(6-methyl-2-pyridinyl)ethanamine;hydrochloride?
The canonical SMILES for (1R)-2,2,2-trifluoro-1-(6-methyl-2-pyridinyl)ethanamine;hydrochloride is Cc1cccc([C@@H](N)C(F)(F)F)n1.Cl.
What is the InChIKey of (1R)-2,2,2-trifluoro-1-(6-methyl-2-pyridinyl)ethanamine;hydrochloride?
The InChIKey is LDSCKDUYXBDJTC-OGFXRTJISA-N. The full InChI is InChI=1S/C8H9F3N2.ClH/c1-5-3-2-4-6(13-5)7(12)8(9,10)11;/h2-4,7H,12H2,1H3;1H/t7-;/m1./s1.
What are the key properties of (1R)-2,2,2-trifluoro-1-(6-methyl-2-pyridinyl)ethanamine;hydrochloride?
(1R)-2,2,2-trifluoro-1-(6-methyl-2-pyridinyl)ethanamine;hydrochloride has a molecular weight of 226.63 g/mol, XLogP of 2.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2,2,2-trifluoro-1-(6-methyl-2-pyridinyl)ethanamine;hydrochloride is sourced from PubChem (CID 171243254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).