C9H10BrF2NO3 — CID 171246277
ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate (PubChem CID 171246277) has the molecular formula C9H10BrF2NO3 and a molecular weight of 298.08 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate.
| Compound Name | ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 171246277 |
| Molecular Formula | C9H10BrF2NO3 |
| Molecular Weight | 298.08 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1ccc(Br)o1 |
| InChI | InChI=1S/C9H10BrF2NO3/c1-2-15-8(14)9(11,12)7(13)5-3-4-6(10)16-5/h3-4,7H,2,13H2,1H3/t7-/m0/s1 |
| InChIKey | CKGARNCHIAKTAC-ZETCQYMHSA-N |
| XLogP | 2.24 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.08 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |