About ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate
ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate (PubChem CID 171246277) has the molecular formula C9H10BrF2NO3
and a molecular weight of 298.08 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate.
Molecular Properties
| Compound Name | ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate |
| PubChem CID | 171246277 |
| Molecular Formula | C9H10BrF2NO3 |
| Molecular Weight | 298.08 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1ccc(Br)o1 |
| InChI | InChI=1S/C9H10BrF2NO3/c1-2-15-8(14)9(11,12)7(13)5-3-4-6(10)16-5/h3-4,7H,2,13H2,1H3/t7-/m0/s1 |
| InChIKey | CKGARNCHIAKTAC-ZETCQYMHSA-N |
| XLogP | 2.24 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.08 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate?
The IUPAC name of ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate (CID 171246277) is ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate.
What is the SMILES notation for ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate?
The canonical SMILES for ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate is CCOC(=O)C(F)(F)[C@@H](N)c1ccc(Br)o1.
What is the InChIKey of ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate?
The InChIKey is CKGARNCHIAKTAC-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H10BrF2NO3/c1-2-15-8(14)9(11,12)7(13)5-3-4-6(10)16-5/h3-4,7H,2,13H2,1H3/t7-/m0/s1.
What are the key properties of ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate?
ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate has a molecular weight of 298.08 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3S)-3-amino-3-(5-bromofuran-2-yl)-2,2-difluoropropanoate is sourced from PubChem (CID 171246277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).