C13H17F2NO3 — CID 171246535
ethyl (3S)-3-amino-3-(4-ethoxyphenyl)-2,2-difluoropropanoate (PubChem CID 171246535) has the molecular formula C13H17F2NO3 and a molecular weight of 273.28 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(4-ethoxyphenyl)-2,2-difluoropropanoate.
| Compound Name | ethyl (3S)-3-amino-3-(4-ethoxyphenyl)-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 171246535 |
| Molecular Formula | C13H17F2NO3 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | ethyl (3S)-3-amino-3-(4-ethoxyphenyl)-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C13H17F2NO3/c1-3-18-10-7-5-9(6-8-10)11(16)13(14,15)12(17)19-4-2/h5-8,11H,3-4,16H2,1-2H3/t11-/m0/s1 |
| InChIKey | UNFGQIAKGVDYHQ-NSHDSACASA-N |
| XLogP | 2.28 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |